C7H7ClN4O — CID 135969130
2-(2-chloroethyl)-5-(1H-pyrazol-4-yl)-1,3,4-oxadiazole (PubChem CID 135969130) has the molecular formula C7H7ClN4O and a molecular weight of 198.61 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-(1H-pyrazol-4-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(2-chloroethyl)-5-(1H-pyrazol-4-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 135969130 |
| Molecular Formula | C7H7ClN4O |
| Molecular Weight | 198.61 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | 2-(2-chloroethyl)-5-(1H-pyrazol-4-yl)-1,3,4-oxadiazole |
| SMILES | ClCCc1nnc(-c2cn[nH]c2)o1 |
| InChI | InChI=1S/C7H7ClN4O/c8-2-1-6-11-12-7(13-6)5-3-9-10-4-5/h3-4H,1-2H2,(H,9,10) |
| InChIKey | KFPVTGQPVBEZMW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.61 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|