C10H10ClN3O — CID 130516109
2-(2-chloroethyl)-5-(3-methyl-4-pyridinyl)-1,3,4-oxadiazole (PubChem CID 130516109) has the molecular formula C10H10ClN3O and a molecular weight of 223.66 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-(3-methyl-4-pyridinyl)-1,3,4-oxadiazole.
| Compound Name | 2-(2-chloroethyl)-5-(3-methyl-4-pyridinyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 130516109 |
| Molecular Formula | C10H10ClN3O |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 2-(2-chloroethyl)-5-(3-methyl-4-pyridinyl)-1,3,4-oxadiazole |
| SMILES | Cc1cnccc1-c1nnc(CCCl)o1 |
| InChI | InChI=1S/C10H10ClN3O/c1-7-6-12-5-3-8(7)10-14-13-9(15-10)2-4-11/h3,5-6H,2,4H2,1H3 |
| InChIKey | MHGCOZHIJBBHEO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|