C13H22N4O — CID 77029852
5-[4-(dimethylamino)anilino]-N'-hydroxypentanimidamide (PubChem CID 77029852) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 5-[4-(dimethylamino)anilino]-N'-hydroxypentanimidamide.
| Compound Name | 5-[4-(dimethylamino)anilino]-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 77029852 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 5-[4-(dimethylamino)anilino]-N'-hydroxypentanimidamide |
| SMILES | CN(C)c1ccc(NCCCCC(N)=NO)cc1 |
| InChI | InChI=1S/C13H22N4O/c1-17(2)12-8-6-11(7-9-12)15-10-4-3-5-13(14)16-18/h6-9,15,18H,3-5,10H2,1-2H3,(H2,14,16) |
| InChIKey | HEVDKMADOUCHPM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|