About 5-(3-fluoro-5-methoxyanilino)-N'-hydroxypentanimidamide
5-(3-fluoro-5-methoxyanilino)-N'-hydroxypentanimidamide (PubChem CID 114263134) has the molecular formula C12H18FN3O2
and a molecular weight of 255.29 g/mol. Its IUPAC name is 5-(3-fluoro-5-methoxyanilino)-N'-hydroxypentanimidamide.
Molecular Properties
| Compound Name | 5-(3-fluoro-5-methoxyanilino)-N'-hydroxypentanimidamide |
| PubChem CID | 114263134 |
| Molecular Formula | C12H18FN3O2 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 5-(3-fluoro-5-methoxyanilino)-N'-hydroxypentanimidamide |
| SMILES | COc1cc(F)cc(NCCCC/C(N)=N/O)c1 |
| InChI | InChI=1S/C12H18FN3O2/c1-18-11-7-9(13)6-10(8-11)15-5-3-2-4-12(14)16-17/h6-8,15,17H,2-5H2,1H3,(H2,14,16) |
| InChIKey | BKDNFLLGJNBYAB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-fluoro-5-methoxyanilino)-N'-hydroxypentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-fluoro-5-methoxyanilino)-N'-hydroxypentanimidamide?
The IUPAC name of 5-(3-fluoro-5-methoxyanilino)-N'-hydroxypentanimidamide (CID 114263134) is 5-(3-fluoro-5-methoxyanilino)-N'-hydroxypentanimidamide.
What is the SMILES notation for 5-(3-fluoro-5-methoxyanilino)-N'-hydroxypentanimidamide?
The canonical SMILES for 5-(3-fluoro-5-methoxyanilino)-N'-hydroxypentanimidamide is COc1cc(F)cc(NCCCC/C(N)=N/O)c1.
What is the InChIKey of 5-(3-fluoro-5-methoxyanilino)-N'-hydroxypentanimidamide?
The InChIKey is BKDNFLLGJNBYAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18FN3O2/c1-18-11-7-9(13)6-10(8-11)15-5-3-2-4-12(14)16-17/h6-8,15,17H,2-5H2,1H3,(H2,14,16).
What are the key properties of 5-(3-fluoro-5-methoxyanilino)-N'-hydroxypentanimidamide?
5-(3-fluoro-5-methoxyanilino)-N'-hydroxypentanimidamide has a molecular weight of 255.29 g/mol, XLogP of 2.16, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-fluoro-5-methoxyanilino)-N'-hydroxypentanimidamide is sourced from PubChem (CID 114263134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).