C14H24N4O — CID 77031382
4-[4-(diethylamino)anilino]-N'-hydroxybutanimidamide (PubChem CID 77031382) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is 4-[4-(diethylamino)anilino]-N'-hydroxybutanimidamide.
| Compound Name | 4-[4-(diethylamino)anilino]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 77031382 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 4-[4-(diethylamino)anilino]-N'-hydroxybutanimidamide |
| SMILES | CCN(CC)c1ccc(NCCCC(N)=NO)cc1 |
| InChI | InChI=1S/C14H24N4O/c1-3-18(4-2)13-9-7-12(8-10-13)16-11-5-6-14(15)17-19/h7-10,16,19H,3-6,11H2,1-2H3,(H2,15,17) |
| InChIKey | BLUGYESKPSRIAC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|