C10H14FN3O — CID 76931380
2-(N-ethyl-4-fluoroanilino)-N'-hydroxyethanimidamide (PubChem CID 76931380) has the molecular formula C10H14FN3O and a molecular weight of 211.24 g/mol. Its IUPAC name is 2-(N-ethyl-4-fluoroanilino)-N'-hydroxyethanimidamide.
| Compound Name | 2-(N-ethyl-4-fluoroanilino)-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 76931380 |
| Molecular Formula | C10H14FN3O |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-(N-ethyl-4-fluoroanilino)-N'-hydroxyethanimidamide |
| SMILES | CCN(CC(N)=NO)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H14FN3O/c1-2-14(7-10(12)13-15)9-5-3-8(11)4-6-9/h3-6,15H,2,7H2,1H3,(H2,12,13) |
| InChIKey | RLVGZTHOPSINPP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|