C14H22FN3O — CID 77062044
4-(N-ethyl-4-fluoroanilino)-N'-hydroxy-2,2-dimethylbutanimidamide (PubChem CID 77062044) has the molecular formula C14H22FN3O and a molecular weight of 267.35 g/mol. Its IUPAC name is 4-(N-ethyl-4-fluoroanilino)-N'-hydroxy-2,2-dimethylbutanimidamide.
| Compound Name | 4-(N-ethyl-4-fluoroanilino)-N'-hydroxy-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 77062044 |
| Molecular Formula | C14H22FN3O |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 4-(N-ethyl-4-fluoroanilino)-N'-hydroxy-2,2-dimethylbutanimidamide |
| SMILES | CCN(CCC(C)(C)C(N)=NO)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H22FN3O/c1-4-18(12-7-5-11(15)6-8-12)10-9-14(2,3)13(16)17-19/h5-8,19H,4,9-10H2,1-3H3,(H2,16,17) |
| InChIKey | XCLLLHMWQTVKRX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|