C11H25N3O — CID 77062836
4-[ethyl(propan-2-yl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide (PubChem CID 77062836) has the molecular formula C11H25N3O and a molecular weight of 215.34 g/mol. Its IUPAC name is 4-[ethyl(propan-2-yl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide.
| Compound Name | 4-[ethyl(propan-2-yl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 77062836 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 4-[ethyl(propan-2-yl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide |
| SMILES | CCN(CCC(C)(C)C(N)=NO)C(C)C |
| InChI | InChI=1S/C11H25N3O/c1-6-14(9(2)3)8-7-11(4,5)10(12)13-15/h9,15H,6-8H2,1-5H3,(H2,12,13) |
| InChIKey | NOWKAZVMFWEGNF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|