C12H26N2S — CID 65246972
4-[butan-2-yl(ethyl)amino]-2,2-dimethylbutanethioamide (PubChem CID 65246972) has the molecular formula C12H26N2S and a molecular weight of 230.42 g/mol. Its IUPAC name is 4-[butan-2-yl(ethyl)amino]-2,2-dimethylbutanethioamide.
| Compound Name | 4-[butan-2-yl(ethyl)amino]-2,2-dimethylbutanethioamide |
|---|---|
| PubChem CID | 65246972 |
| Molecular Formula | C12H26N2S |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 4-[butan-2-yl(ethyl)amino]-2,2-dimethylbutanethioamide |
| SMILES | CCC(C)N(CC)CCC(C)(C)C(N)=S |
| InChI | InChI=1S/C12H26N2S/c1-6-10(3)14(7-2)9-8-12(4,5)11(13)15/h10H,6-9H2,1-5H3,(H2,13,15) |
| InChIKey | FIOOBJNBCFVZBT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|