C13H28N2OS — CID 65249083
4-[butan-2-yl(2-methoxyethyl)amino]-2,2-dimethylbutanethioamide (PubChem CID 65249083) has the molecular formula C13H28N2OS and a molecular weight of 260.45 g/mol. Its IUPAC name is 4-[butan-2-yl(2-methoxyethyl)amino]-2,2-dimethylbutanethioamide.
| Compound Name | 4-[butan-2-yl(2-methoxyethyl)amino]-2,2-dimethylbutanethioamide |
|---|---|
| PubChem CID | 65249083 |
| Molecular Formula | C13H28N2OS |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 4-[butan-2-yl(2-methoxyethyl)amino]-2,2-dimethylbutanethioamide |
| SMILES | CCC(C)N(CCOC)CCC(C)(C)C(N)=S |
| InChI | InChI=1S/C13H28N2OS/c1-6-11(2)15(9-10-16-5)8-7-13(3,4)12(14)17/h11H,6-10H2,1-5H3,(H2,14,17) |
| InChIKey | IALQKYLKITYBMR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|