C14H30N2S — CID 65249143
4-[butan-2-yl(butyl)amino]-2,2-dimethylbutanethioamide (PubChem CID 65249143) has the molecular formula C14H30N2S and a molecular weight of 258.47 g/mol. Its IUPAC name is 4-[butan-2-yl(butyl)amino]-2,2-dimethylbutanethioamide.
| Compound Name | 4-[butan-2-yl(butyl)amino]-2,2-dimethylbutanethioamide |
|---|---|
| PubChem CID | 65249143 |
| Molecular Formula | C14H30N2S |
| Molecular Weight | 258.47 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 4-[butan-2-yl(butyl)amino]-2,2-dimethylbutanethioamide |
| SMILES | CCCCN(CCC(C)(C)C(N)=S)C(C)CC |
| InChI | InChI=1S/C14H30N2S/c1-6-8-10-16(12(3)7-2)11-9-14(4,5)13(15)17/h12H,6-11H2,1-5H3,(H2,15,17) |
| InChIKey | JCVGQLIWJAGVLK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|