C12H26N2OS — CID 65248852
4-[3-hydroxypropyl(propan-2-yl)amino]-2,2-dimethylbutanethioamide (PubChem CID 65248852) has the molecular formula C12H26N2OS and a molecular weight of 246.42 g/mol. Its IUPAC name is 4-[3-hydroxypropyl(propan-2-yl)amino]-2,2-dimethylbutanethioamide.
| Compound Name | 4-[3-hydroxypropyl(propan-2-yl)amino]-2,2-dimethylbutanethioamide |
|---|---|
| PubChem CID | 65248852 |
| Molecular Formula | C12H26N2OS |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 4-[3-hydroxypropyl(propan-2-yl)amino]-2,2-dimethylbutanethioamide |
| SMILES | CC(C)N(CCCO)CCC(C)(C)C(N)=S |
| InChI | InChI=1S/C12H26N2OS/c1-10(2)14(7-5-9-15)8-6-12(3,4)11(13)16/h10,15H,5-9H2,1-4H3,(H2,13,16) |
| InChIKey | GFNXAUVOBIKOFF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|