About 3-[(3-amino-4,4-dimethylpentyl)-propan-2-ylamino]propan-1-ol
3-[(3-amino-4,4-dimethylpentyl)-propan-2-ylamino]propan-1-ol (PubChem CID 62623197) has the molecular formula C13H30N2O
and a molecular weight of 230.40 g/mol. Its IUPAC name is 3-[(3-amino-4,4-dimethylpentyl)-propan-2-ylamino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(3-amino-4,4-dimethylpentyl)-propan-2-ylamino]propan-1-ol |
| PubChem CID | 62623197 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | 3-[(3-amino-4,4-dimethylpentyl)-propan-2-ylamino]propan-1-ol |
| SMILES | CC(C)N(CCCO)CCC(N)C(C)(C)C |
| InChI | InChI=1S/C13H30N2O/c1-11(2)15(8-6-10-16)9-7-12(14)13(3,4)5/h11-12,16H,6-10,14H2,1-5H3 |
| InChIKey | ATNZYYMUIRANFY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(3-amino-4,4-dimethylpentyl)-propan-2-ylamino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-amino-4,4-dimethylpentyl)-propan-2-ylamino]propan-1-ol?
The IUPAC name of 3-[(3-amino-4,4-dimethylpentyl)-propan-2-ylamino]propan-1-ol (CID 62623197) is 3-[(3-amino-4,4-dimethylpentyl)-propan-2-ylamino]propan-1-ol.
What is the SMILES notation for 3-[(3-amino-4,4-dimethylpentyl)-propan-2-ylamino]propan-1-ol?
The canonical SMILES for 3-[(3-amino-4,4-dimethylpentyl)-propan-2-ylamino]propan-1-ol is CC(C)N(CCCO)CCC(N)C(C)(C)C.
What is the InChIKey of 3-[(3-amino-4,4-dimethylpentyl)-propan-2-ylamino]propan-1-ol?
The InChIKey is ATNZYYMUIRANFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30N2O/c1-11(2)15(8-6-10-16)9-7-12(14)13(3,4)5/h11-12,16H,6-10,14H2,1-5H3.
What are the key properties of 3-[(3-amino-4,4-dimethylpentyl)-propan-2-ylamino]propan-1-ol?
3-[(3-amino-4,4-dimethylpentyl)-propan-2-ylamino]propan-1-ol has a molecular weight of 230.40 g/mol, XLogP of 1.84, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-amino-4,4-dimethylpentyl)-propan-2-ylamino]propan-1-ol is sourced from PubChem (CID 62623197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).