C16H35N3O — CID 106710790
6-[ethyl(2-ethylbutyl)amino]-N'-hydroxy-2,2-dimethylhexanimidamide (PubChem CID 106710790) has the molecular formula C16H35N3O and a molecular weight of 285.48 g/mol. Its IUPAC name is 6-[ethyl(2-ethylbutyl)amino]-N'-hydroxy-2,2-dimethylhexanimidamide.
| Compound Name | 6-[ethyl(2-ethylbutyl)amino]-N'-hydroxy-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 106710790 |
| Molecular Formula | C16H35N3O |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.28 |
| IUPAC Name | 6-[ethyl(2-ethylbutyl)amino]-N'-hydroxy-2,2-dimethylhexanimidamide |
| SMILES | CCC(CC)CN(CC)CCCCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C16H35N3O/c1-6-14(7-2)13-19(8-3)12-10-9-11-16(4,5)15(17)18-20/h14,20H,6-13H2,1-5H3,(H2,17,18) |
| InChIKey | MQTZNHZYTXHTNX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|