C10H14FN — CID 592416
N,N-diethyl-4-fluoroaniline (PubChem CID 592416) has the molecular formula C10H14FN and a molecular weight of 167.23 g/mol. Its IUPAC name is N,N-diethyl-4-fluoroaniline.
| Compound Name | N,N-diethyl-4-fluoroaniline |
|---|---|
| PubChem CID | 592416 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | N,N-diethyl-4-fluoroaniline |
| SMILES | CCN(CC)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H14FN/c1-3-12(4-2)10-7-5-9(11)6-8-10/h5-8H,3-4H2,1-2H3 |
| InChIKey | BLGCFZZVFXBRSW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |