C19H25ClFN2- — CID 53351243
N,N-diethyl-4-[[2-(4-fluorophenyl)ethylamino]methyl]aniline chloride (PubChem CID 53351243) has the molecular formula C19H25ClFN2- and a molecular weight of 335.87 g/mol. Its IUPAC name is N,N-diethyl-4-[[2-(4-fluorophenyl)ethylamino]methyl]aniline chloride.
| Compound Name | N,N-diethyl-4-[[2-(4-fluorophenyl)ethylamino]methyl]aniline chloride |
|---|---|
| PubChem CID | 53351243 |
| Molecular Formula | C19H25ClFN2- |
| Molecular Weight | 335.87 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N,N-diethyl-4-[[2-(4-fluorophenyl)ethylamino]methyl]aniline chloride |
| SMILES | CCN(CC)c1ccc(CNCCc2ccc(F)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C19H25FN2.ClH/c1-3-22(4-2)19-11-7-17(8-12-19)15-21-14-13-16-5-9-18(20)10-6-16;/h5-12,21H,3-4,13-15H2,1-2H3;1H/p-1 |
| InChIKey | WYIDAEGMERVGTG-UHFFFAOYSA-M |
| XLogP | 1.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.87 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|