C20H28N2O — CID 4719727
N,N-diethyl-4-[[2-(4-methoxyphenyl)ethylamino]methyl]aniline (PubChem CID 4719727) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is N,N-diethyl-4-[[2-(4-methoxyphenyl)ethylamino]methyl]aniline.
| Compound Name | N,N-diethyl-4-[[2-(4-methoxyphenyl)ethylamino]methyl]aniline |
|---|---|
| PubChem CID | 4719727 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | N,N-diethyl-4-[[2-(4-methoxyphenyl)ethylamino]methyl]aniline |
| SMILES | CCN(CC)c1ccc(CNCCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H28N2O/c1-4-22(5-2)19-10-6-18(7-11-19)16-21-15-14-17-8-12-20(23-3)13-9-17/h6-13,21H,4-5,14-16H2,1-3H3 |
| InChIKey | BXOACTDVTFBLNS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|