C21H28N2O4 — CID 163327241
N,N-diethyl-4-[(2-phenylethylamino)methyl]aniline;oxalic acid (PubChem CID 163327241) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is N,N-diethyl-4-[(2-phenylethylamino)methyl]aniline;oxalic acid.
| Compound Name | N,N-diethyl-4-[(2-phenylethylamino)methyl]aniline;oxalic acid |
|---|---|
| PubChem CID | 163327241 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N,N-diethyl-4-[(2-phenylethylamino)methyl]aniline;oxalic acid |
| SMILES | CCN(CC)c1ccc(CNCCc2ccccc2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H26N2.C2H2O4/c1-3-21(4-2)19-12-10-18(11-13-19)16-20-15-14-17-8-6-5-7-9-17;3-1(4)2(5)6/h5-13,20H,3-4,14-16H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | QHJZNKLXZAIMMM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|