C17H31ClN2 — CID 17293948
N,N-diethyl-4-[(hexylamino)methyl]aniline;hydrochloride (PubChem CID 17293948) has the molecular formula C17H31ClN2 and a molecular weight of 298.90 g/mol. Its IUPAC name is N,N-diethyl-4-[(hexylamino)methyl]aniline;hydrochloride.
| Compound Name | N,N-diethyl-4-[(hexylamino)methyl]aniline;hydrochloride |
|---|---|
| PubChem CID | 17293948 |
| Molecular Formula | C17H31ClN2 |
| Molecular Weight | 298.90 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | N,N-diethyl-4-[(hexylamino)methyl]aniline;hydrochloride |
| SMILES | CCCCCCNCc1ccc(N(CC)CC)cc1.Cl |
| InChI | InChI=1S/C17H30N2.ClH/c1-4-7-8-9-14-18-15-16-10-12-17(13-11-16)19(5-2)6-3;/h10-13,18H,4-9,14-15H2,1-3H3;1H |
| InChIKey | YPICYWYRFMZAGY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.90 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|