C21H38N2 — CID 54404643
N,N-ditert-butyl-4-[(hexylamino)methyl]aniline (PubChem CID 54404643) has the molecular formula C21H38N2 and a molecular weight of 318.55 g/mol. Its IUPAC name is N,N-ditert-butyl-4-[(hexylamino)methyl]aniline.
| Compound Name | N,N-ditert-butyl-4-[(hexylamino)methyl]aniline |
|---|---|
| PubChem CID | 54404643 |
| Molecular Formula | C21H38N2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.30 |
| IUPAC Name | N,N-ditert-butyl-4-[(hexylamino)methyl]aniline |
| SMILES | CCCCCCNCc1ccc(N(C(C)(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H38N2/c1-8-9-10-11-16-22-17-18-12-14-19(15-13-18)23(20(2,3)4)21(5,6)7/h12-15,22H,8-11,16-17H2,1-7H3 |
| InChIKey | VPVATHUEFOCVAV-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|