C14H21F3N2 — CID 115513702
4-N,4-N-diethyl-1-N-(4,4,4-trifluorobutyl)benzene-1,4-diamine (PubChem CID 115513702) has the molecular formula C14H21F3N2 and a molecular weight of 274.33 g/mol. Its IUPAC name is 4-N,4-N-diethyl-1-N-(4,4,4-trifluorobutyl)benzene-1,4-diamine.
| Compound Name | 4-N,4-N-diethyl-1-N-(4,4,4-trifluorobutyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 115513702 |
| Molecular Formula | C14H21F3N2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 4-N,4-N-diethyl-1-N-(4,4,4-trifluorobutyl)benzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(NCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H21F3N2/c1-3-19(4-2)13-8-6-12(7-9-13)18-11-5-10-14(15,16)17/h6-9,18H,3-5,10-11H2,1-2H3 |
| InChIKey | YWZXYRIITOUDRK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|