C13H17ClN2O — CID 65247556
4-(3-chloro-4-methoxyanilino)-2,2-dimethylbutanenitrile (PubChem CID 65247556) has the molecular formula C13H17ClN2O and a molecular weight of 252.75 g/mol. Its IUPAC name is 4-(3-chloro-4-methoxyanilino)-2,2-dimethylbutanenitrile.
| Compound Name | 4-(3-chloro-4-methoxyanilino)-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 65247556 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.75 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 4-(3-chloro-4-methoxyanilino)-2,2-dimethylbutanenitrile |
| SMILES | COc1ccc(NCCC(C)(C)C#N)cc1Cl |
| InChI | InChI=1S/C13H17ClN2O/c1-13(2,9-15)6-7-16-10-4-5-12(17-3)11(14)8-10/h4-5,8,16H,6-7H2,1-3H3 |
| InChIKey | RWGLQOWOLZPNDL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.75 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|