C14H20N2O2 — CID 65247502
4-(2,4-dimethoxyanilino)-2,2-dimethylbutanenitrile (PubChem CID 65247502) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 4-(2,4-dimethoxyanilino)-2,2-dimethylbutanenitrile.
| Compound Name | 4-(2,4-dimethoxyanilino)-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 65247502 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 4-(2,4-dimethoxyanilino)-2,2-dimethylbutanenitrile |
| SMILES | COc1ccc(NCCC(C)(C)C#N)c(OC)c1 |
| InChI | InChI=1S/C14H20N2O2/c1-14(2,10-15)7-8-16-12-6-5-11(17-3)9-13(12)18-4/h5-6,9,16H,7-8H2,1-4H3 |
| InChIKey | WCLNBZVIRUQLNM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|