C12H20N2O2 — CID 82114957
N'-(2,4-dimethoxyphenyl)butane-1,4-diamine (PubChem CID 82114957) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is N'-(2,4-dimethoxyphenyl)butane-1,4-diamine.
| Compound Name | N'-(2,4-dimethoxyphenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 82114957 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N'-(2,4-dimethoxyphenyl)butane-1,4-diamine |
| SMILES | COc1ccc(NCCCCN)c(OC)c1 |
| InChI | InChI=1S/C12H20N2O2/c1-15-10-5-6-11(12(9-10)16-2)14-8-4-3-7-13/h5-6,9,14H,3-4,7-8,13H2,1-2H3 |
| InChIKey | CQUHNBDIIZOVQD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|