C15H14Cl3NO2 — CID 54798735
3-chloro-N-[2-(2,4-dichlorophenoxy)ethyl]-4-methoxyaniline (PubChem CID 54798735) has the molecular formula C15H14Cl3NO2 and a molecular weight of 346.64 g/mol. Its IUPAC name is 3-chloro-N-[2-(2,4-dichlorophenoxy)ethyl]-4-methoxyaniline.
| Compound Name | 3-chloro-N-[2-(2,4-dichlorophenoxy)ethyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 54798735 |
| Molecular Formula | C15H14Cl3NO2 |
| Molecular Weight | 346.64 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 3-chloro-N-[2-(2,4-dichlorophenoxy)ethyl]-4-methoxyaniline |
| SMILES | COc1ccc(NCCOc2ccc(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C15H14Cl3NO2/c1-20-14-5-3-11(9-13(14)18)19-6-7-21-15-4-2-10(16)8-12(15)17/h2-5,8-9,19H,6-7H2,1H3 |
| InChIKey | YRGZUYDWEDVCCL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.64 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|