C18H17Cl2NO5 — CID 69402138
methyl 2-acetyloxy-5-[2-(2,4-dichlorophenoxy)ethylamino]benzoate (PubChem CID 69402138) has the molecular formula C18H17Cl2NO5 and a molecular weight of 398.24 g/mol. Its IUPAC name is methyl 2-acetyloxy-5-[2-(2,4-dichlorophenoxy)ethylamino]benzoate.
| Compound Name | methyl 2-acetyloxy-5-[2-(2,4-dichlorophenoxy)ethylamino]benzoate |
|---|---|
| PubChem CID | 69402138 |
| Molecular Formula | C18H17Cl2NO5 |
| Molecular Weight | 398.24 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | methyl 2-acetyloxy-5-[2-(2,4-dichlorophenoxy)ethylamino]benzoate |
| SMILES | COC(=O)c1cc(NCCOc2ccc(Cl)cc2Cl)ccc1OC(C)=O |
| InChI | InChI=1S/C18H17Cl2NO5/c1-11(22)26-16-6-4-13(10-14(16)18(23)24-2)21-7-8-25-17-5-3-12(19)9-15(17)20/h3-6,9-10,21H,7-8H2,1-2H3 |
| InChIKey | HOPPVCXTJRTTAN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.24 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|