C19H22BrNO6 — CID 69402341
2-acetyloxy-5-[2-(4-bromophenoxy)ethylamino]benzoic acid;methoxymethane (PubChem CID 69402341) has the molecular formula C19H22BrNO6 and a molecular weight of 440.29 g/mol. Its IUPAC name is 2-acetyloxy-5-[2-(4-bromophenoxy)ethylamino]benzoic acid;methoxymethane.
| Compound Name | 2-acetyloxy-5-[2-(4-bromophenoxy)ethylamino]benzoic acid;methoxymethane |
|---|---|
| PubChem CID | 69402341 |
| Molecular Formula | C19H22BrNO6 |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 2-acetyloxy-5-[2-(4-bromophenoxy)ethylamino]benzoic acid;methoxymethane |
| SMILES | CC(=O)Oc1ccc(NCCOc2ccc(Br)cc2)cc1C(=O)O.COC |
| InChI | InChI=1S/C17H16BrNO5.C2H6O/c1-11(20)24-16-7-4-13(10-15(16)17(21)22)19-8-9-23-14-5-2-12(18)3-6-14;1-3-2/h2-7,10,19H,8-9H2,1H3,(H,21,22);1-2H3 |
| InChIKey | YBWMUPWVSVPDPI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|