C19H21NO6S — CID 69402000
2-acetyloxy-5-[(2-phenylsulfanylacetyl)amino]benzoic acid;methoxymethane (PubChem CID 69402000) has the molecular formula C19H21NO6S and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-acetyloxy-5-[(2-phenylsulfanylacetyl)amino]benzoic acid;methoxymethane.
| Compound Name | 2-acetyloxy-5-[(2-phenylsulfanylacetyl)amino]benzoic acid;methoxymethane |
|---|---|
| PubChem CID | 69402000 |
| Molecular Formula | C19H21NO6S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 2-acetyloxy-5-[(2-phenylsulfanylacetyl)amino]benzoic acid;methoxymethane |
| SMILES | CC(=O)Oc1ccc(NC(=O)CSc2ccccc2)cc1C(=O)O.COC |
| InChI | InChI=1S/C17H15NO5S.C2H6O/c1-11(19)23-15-8-7-12(9-14(15)17(21)22)18-16(20)10-24-13-5-3-2-4-6-13;1-3-2/h2-9H,10H2,1H3,(H,18,20)(H,21,22);1-2H3 |
| InChIKey | OOLPBORATLVPRN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|