C23H20N2O6S — CID 22782785
2-hydroxy-5-[[2-[4-[(2-phenoxyacetyl)amino]phenyl]sulfanylacetyl]amino]benzoic acid (PubChem CID 22782785) has the molecular formula C23H20N2O6S and a molecular weight of 452.49 g/mol. Its IUPAC name is 2-hydroxy-5-[[2-[4-[(2-phenoxyacetyl)amino]phenyl]sulfanylacetyl]amino]benzoic acid.
| Compound Name | 2-hydroxy-5-[[2-[4-[(2-phenoxyacetyl)amino]phenyl]sulfanylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 22782785 |
| Molecular Formula | C23H20N2O6S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 2-hydroxy-5-[[2-[4-[(2-phenoxyacetyl)amino]phenyl]sulfanylacetyl]amino]benzoic acid |
| SMILES | O=C(COc1ccccc1)Nc1ccc(SCC(=O)Nc2ccc(O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C23H20N2O6S/c26-20-11-8-16(12-19(20)23(29)30)25-22(28)14-32-18-9-6-15(7-10-18)24-21(27)13-31-17-4-2-1-3-5-17/h1-12,26H,13-14H2,(H,24,27)(H,25,28)(H,29,30) |
| InChIKey | JAWYRPOSFVWPMV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|