C23H21NO4S — CID 19631701
N-[4-[2-(2-methoxyphenyl)-2-oxoethyl]sulfanylphenyl]-2-phenoxyacetamide (PubChem CID 19631701) has the molecular formula C23H21NO4S and a molecular weight of 407.49 g/mol. Its IUPAC name is N-[4-[2-(2-methoxyphenyl)-2-oxoethyl]sulfanylphenyl]-2-phenoxyacetamide.
| Compound Name | N-[4-[2-(2-methoxyphenyl)-2-oxoethyl]sulfanylphenyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 19631701 |
| Molecular Formula | C23H21NO4S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-[4-[2-(2-methoxyphenyl)-2-oxoethyl]sulfanylphenyl]-2-phenoxyacetamide |
| SMILES | COc1ccccc1C(=O)CSc1ccc(NC(=O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C23H21NO4S/c1-27-22-10-6-5-9-20(22)21(25)16-29-19-13-11-17(12-14-19)24-23(26)15-28-18-7-3-2-4-8-18/h2-14H,15-16H2,1H3,(H,24,26) |
| InChIKey | FFMZFYJJKGJXND-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |