C15H12BrCl2NO3 — CID 18803945
2-[2-(4-bromophenoxy)ethylamino]-3,5-dichlorobenzoic acid (PubChem CID 18803945) has the molecular formula C15H12BrCl2NO3 and a molecular weight of 405.08 g/mol. Its IUPAC name is 2-[2-(4-bromophenoxy)ethylamino]-3,5-dichlorobenzoic acid.
| Compound Name | 2-[2-(4-bromophenoxy)ethylamino]-3,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 18803945 |
| Molecular Formula | C15H12BrCl2NO3 |
| Molecular Weight | 405.08 g/mol |
| Exact Mass | 402.94 |
| IUPAC Name | 2-[2-(4-bromophenoxy)ethylamino]-3,5-dichlorobenzoic acid |
| SMILES | O=C(O)c1cc(Cl)cc(Cl)c1NCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H12BrCl2NO3/c16-9-1-3-11(4-2-9)22-6-5-19-14-12(15(20)21)7-10(17)8-13(14)18/h1-4,7-8,19H,5-6H2,(H,20,21) |
| InChIKey | UCVKAVDANAQNSS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.08 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|