3,5-dichloro-2-[3-(4-chlorophenoxy)propylamino]benzoic acid

C16H14Cl3NO3 — CID 18803961

IUPAC3,5-dichloro-2-[3-(4-chlorophenoxy)propylamino]benzoic acid
SMILESO=C(O)c1cc(Cl)cc(Cl)c1NCCCOc1ccc(Cl)cc1
InChIInChI=1S/C16H14Cl3NO3/c17-10-2-4-12(5-3-10)23-7-1-6-20-15-13(16(21)22)8-11(18)9-14(15)19/h2-5,8-9,20H,1,6-7H2,(H,21,22)
InChIKeyWCRNMAMQCBKDHU-UHFFFAOYSA-N
MW374.65 g/mol
LogP5.23
Rot. Bonds7

About 3,5-dichloro-2-[3-(4-chlorophenoxy)propylamino]benzoic acid

3,5-dichloro-2-[3-(4-chlorophenoxy)propylamino]benzoic acid (PubChem CID 18803961) has the molecular formula C16H14Cl3NO3 and a molecular weight of 374.65 g/mol. Its IUPAC name is 3,5-dichloro-2-[3-(4-chlorophenoxy)propylamino]benzoic acid.

Molecular Properties

Compound Name3,5-dichloro-2-[3-(4-chlorophenoxy)propylamino]benzoic acid
PubChem CID18803961
Molecular FormulaC16H14Cl3NO3
Molecular Weight374.65 g/mol
Exact Mass373.00
IUPAC Name3,5-dichloro-2-[3-(4-chlorophenoxy)propylamino]benzoic acid
SMILESO=C(O)c1cc(Cl)cc(Cl)c1NCCCOc1ccc(Cl)cc1
InChIInChI=1S/C16H14Cl3NO3/c17-10-2-4-12(5-3-10)23-7-1-6-20-15-13(16(21)22)8-11(18)9-14(15)19/h2-5,8-9,20H,1,6-7H2,(H,21,22)
InChIKeyWCRNMAMQCBKDHU-UHFFFAOYSA-N
XLogP5.23
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500374.65
LogP ≤ 55.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3,5-dichloro-2-[3-(4-chlorophenoxy)propylamino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dichloro-2-[3-(4-chlorophenoxy)propylamino]benzoic acid?
The IUPAC name of 3,5-dichloro-2-[3-(4-chlorophenoxy)propylamino]benzoic acid (CID 18803961) is 3,5-dichloro-2-[3-(4-chlorophenoxy)propylamino]benzoic acid.
What is the SMILES notation for 3,5-dichloro-2-[3-(4-chlorophenoxy)propylamino]benzoic acid?
The canonical SMILES for 3,5-dichloro-2-[3-(4-chlorophenoxy)propylamino]benzoic acid is O=C(O)c1cc(Cl)cc(Cl)c1NCCCOc1ccc(Cl)cc1.
What is the InChIKey of 3,5-dichloro-2-[3-(4-chlorophenoxy)propylamino]benzoic acid?
The InChIKey is WCRNMAMQCBKDHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl3NO3/c17-10-2-4-12(5-3-10)23-7-1-6-20-15-13(16(21)22)8-11(18)9-14(15)19/h2-5,8-9,20H,1,6-7H2,(H,21,22).
What are the key properties of 3,5-dichloro-2-[3-(4-chlorophenoxy)propylamino]benzoic acid?
3,5-dichloro-2-[3-(4-chlorophenoxy)propylamino]benzoic acid has a molecular weight of 374.65 g/mol, XLogP of 5.23, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-2-[3-(4-chlorophenoxy)propylamino]benzoic acid is sourced from PubChem (CID 18803961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).