C18H19Cl2NO3 — CID 18803442
2-[4-(3,5-dichlorophenoxy)butylamino]-3-methylbenzoic acid (PubChem CID 18803442) has the molecular formula C18H19Cl2NO3 and a molecular weight of 368.26 g/mol. Its IUPAC name is 2-[4-(3,5-dichlorophenoxy)butylamino]-3-methylbenzoic acid.
| Compound Name | 2-[4-(3,5-dichlorophenoxy)butylamino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 18803442 |
| Molecular Formula | C18H19Cl2NO3 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 2-[4-(3,5-dichlorophenoxy)butylamino]-3-methylbenzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1NCCCCOc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H19Cl2NO3/c1-12-5-4-6-16(18(22)23)17(12)21-7-2-3-8-24-15-10-13(19)9-14(20)11-15/h4-6,9-11,21H,2-3,7-8H2,1H3,(H,22,23) |
| InChIKey | YUKIJPXMEZPWGR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|