C14H12BrCl2NO — CID 63487856
4-bromo-2,6-dichloro-N-(2-phenoxyethyl)aniline (PubChem CID 63487856) has the molecular formula C14H12BrCl2NO and a molecular weight of 361.07 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(2-phenoxyethyl)aniline.
| Compound Name | 4-bromo-2,6-dichloro-N-(2-phenoxyethyl)aniline |
|---|---|
| PubChem CID | 63487856 |
| Molecular Formula | C14H12BrCl2NO |
| Molecular Weight | 361.07 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(2-phenoxyethyl)aniline |
| SMILES | Clc1cc(Br)cc(Cl)c1NCCOc1ccccc1 |
| InChI | InChI=1S/C14H12BrCl2NO/c15-10-8-12(16)14(13(17)9-10)18-6-7-19-11-4-2-1-3-5-11/h1-5,8-9,18H,6-7H2 |
| InChIKey | WCJPQLYDHILXPD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.07 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|