C16H14BrNO5 — CID 141230693
2-acetyloxy-5-[(5-bromo-2-hydroxyphenyl)methylamino]benzoic acid (PubChem CID 141230693) has the molecular formula C16H14BrNO5 and a molecular weight of 380.19 g/mol. Its IUPAC name is 2-acetyloxy-5-[(5-bromo-2-hydroxyphenyl)methylamino]benzoic acid.
| Compound Name | 2-acetyloxy-5-[(5-bromo-2-hydroxyphenyl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 141230693 |
| Molecular Formula | C16H14BrNO5 |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 2-acetyloxy-5-[(5-bromo-2-hydroxyphenyl)methylamino]benzoic acid |
| SMILES | CC(=O)Oc1ccc(NCc2cc(Br)ccc2O)cc1C(=O)O |
| InChI | InChI=1S/C16H14BrNO5/c1-9(19)23-15-5-3-12(7-13(15)16(21)22)18-8-10-6-11(17)2-4-14(10)20/h2-7,18,20H,8H2,1H3,(H,21,22) |
| InChIKey | BBNCINZTRCBAAP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|