C26H30BrNO5 — CID 90384495
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-acetyloxy-4-[(5-bromo-2-hydroxyphenyl)methylamino]benzoate (PubChem CID 90384495) has the molecular formula C26H30BrNO5 and a molecular weight of 516.43 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-acetyloxy-4-[(5-bromo-2-hydroxyphenyl)methylamino]benzoate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-acetyloxy-4-[(5-bromo-2-hydroxyphenyl)methylamino]benzoate |
|---|---|
| PubChem CID | 90384495 |
| Molecular Formula | C26H30BrNO5 |
| Molecular Weight | 516.43 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-acetyloxy-4-[(5-bromo-2-hydroxyphenyl)methylamino]benzoate |
| SMILES | CC(=O)Oc1cc(NCc2cc(Br)ccc2O)ccc1C(=O)OC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C26H30BrNO5/c1-15(29)32-22-13-19(28-14-16-11-18(27)5-8-21(16)30)6-7-20(22)24(31)33-23-12-17-9-10-26(23,4)25(17,2)3/h5-8,11,13,17,23,28,30H,9-10,12,14H2,1-4H3 |
| InChIKey | VOQBKQRLYBMMJY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.43 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|