C26H29Cl2NO5 — CID 90384504
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-acetyloxy-5-[(3,5-dichloro-2-hydroxyphenyl)methylamino]benzoate (PubChem CID 90384504) has the molecular formula C26H29Cl2NO5 and a molecular weight of 506.43 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-acetyloxy-5-[(3,5-dichloro-2-hydroxyphenyl)methylamino]benzoate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-acetyloxy-5-[(3,5-dichloro-2-hydroxyphenyl)methylamino]benzoate |
|---|---|
| PubChem CID | 90384504 |
| Molecular Formula | C26H29Cl2NO5 |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-acetyloxy-5-[(3,5-dichloro-2-hydroxyphenyl)methylamino]benzoate |
| SMILES | CC(=O)Oc1ccc(NCc2cc(Cl)cc(Cl)c2O)cc1C(=O)OC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C26H29Cl2NO5/c1-14(30)33-21-6-5-18(29-13-15-9-17(27)11-20(28)23(15)31)12-19(21)24(32)34-22-10-16-7-8-26(22,4)25(16,2)3/h5-6,9,11-12,16,22,29,31H,7-8,10,13H2,1-4H3 |
| InChIKey | KAPCZEMHOOTXHQ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|