C19H24O4 — CID 162999671
[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 4-acetyloxybenzoate (PubChem CID 162999671) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is [(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 4-acetyloxybenzoate.
| Compound Name | [(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 4-acetyloxybenzoate |
|---|---|
| PubChem CID | 162999671 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | [(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 4-acetyloxybenzoate |
| SMILES | CC(=O)Oc1ccc(C(=O)O[C@@H]2C[C@H]3CC[C@]2(C)C3(C)C)cc1 |
| InChI | InChI=1S/C19H24O4/c1-12(20)22-15-7-5-13(6-8-15)17(21)23-16-11-14-9-10-19(16,4)18(14,2)3/h5-8,14,16H,9-11H2,1-4H3/t14-,16-,19+/m1/s1 |
| InChIKey | UGDUVCVZRMRJRH-OGWOLHLISA-N |
| XLogP | 3.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|