C39H44O7 — CID 101341870
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl]benzoate (PubChem CID 101341870) has the molecular formula C39H44O7 and a molecular weight of 624.77 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl]benzoate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl]benzoate |
|---|---|
| PubChem CID | 101341870 |
| Molecular Formula | C39H44O7 |
| Molecular Weight | 624.77 g/mol |
| Exact Mass | 624.31 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl]benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(C(=O)OC4CC5CCC4(C)C5(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H44O7/c1-5-35(40)44-25-9-7-6-8-24-43-32-18-16-30(17-19-32)36(41)45-33-20-14-28(15-21-33)27-10-12-29(13-11-27)37(42)46-34-26-31-22-23-39(34,4)38(31,2)3/h5,10-21,31,34H,1,6-9,22-26H2,2-4H3 |
| InChIKey | DOVPBNKQXNNCEA-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.77 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|