C32H38O4 — CID 102302192
[4-[[(1S,2R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxycarbonyl]phenyl] 4-oct-1-ynylbenzoate (PubChem CID 102302192) has the molecular formula C32H38O4 and a molecular weight of 486.65 g/mol. Its IUPAC name is [4-[[(1S,2R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxycarbonyl]phenyl] 4-oct-1-ynylbenzoate.
| Compound Name | [4-[[(1S,2R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxycarbonyl]phenyl] 4-oct-1-ynylbenzoate |
|---|---|
| PubChem CID | 102302192 |
| Molecular Formula | C32H38O4 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | [4-[[(1S,2R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxycarbonyl]phenyl] 4-oct-1-ynylbenzoate |
| SMILES | CCCCCCC#Cc1ccc(C(=O)Oc2ccc(C(=O)O[C@@H]3CC4CC[C@@]3(C)C4(C)C)cc2)cc1 |
| InChI | InChI=1S/C32H38O4/c1-5-6-7-8-9-10-11-23-12-14-24(15-13-23)29(33)35-27-18-16-25(17-19-27)30(34)36-28-22-26-20-21-32(28,4)31(26,2)3/h12-19,26,28H,5-9,20-22H2,1-4H3/t26?,28-,32-/m1/s1 |
| InChIKey | UTSBLQPXAZPEMI-BSSNDRIJSA-N |
| XLogP | 7.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|