C57H54O6 — CID 101061164
tris(4-deca-1,3-diynylphenyl) benzene-1,3,5-tricarboxylate (PubChem CID 101061164) has the molecular formula C57H54O6 and a molecular weight of 835.05 g/mol. Its IUPAC name is tris(4-deca-1,3-diynylphenyl) benzene-1,3,5-tricarboxylate.
| Compound Name | tris(4-deca-1,3-diynylphenyl) benzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 101061164 |
| Molecular Formula | C57H54O6 |
| Molecular Weight | 835.05 g/mol |
| Exact Mass | 834.39 |
| IUPAC Name | tris(4-deca-1,3-diynylphenyl) benzene-1,3,5-tricarboxylate |
| SMILES | CCCCCCC#CC#Cc1ccc(OC(=O)c2cc(C(=O)Oc3ccc(C#CC#CCCCCCC)cc3)cc(C(=O)Oc3ccc(C#CC#CCCCCCC)cc3)c2)cc1 |
| InChI | InChI=1S/C57H54O6/c1-4-7-10-13-16-19-22-25-28-46-31-37-52(38-32-46)61-55(58)49-43-50(56(59)62-53-39-33-47(34-40-53)29-26-23-20-17-14-11-8-5-2)45-51(44-49)57(60)63-54-41-35-48(36-42-54)30-27-24-21-18-15-12-9-6-3/h31-45H,4-18H2,1-3H3 |
| InChIKey | IMNDENACWNNAMC-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.05 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|