C17H20O — CID 11172515
1-deca-1,3-diynyl-4-methoxybenzene (PubChem CID 11172515) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-deca-1,3-diynyl-4-methoxybenzene.
| Compound Name | 1-deca-1,3-diynyl-4-methoxybenzene |
|---|---|
| PubChem CID | 11172515 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 1-deca-1,3-diynyl-4-methoxybenzene |
| SMILES | CCCCCCC#CC#Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C17H20O/c1-3-4-5-6-7-8-9-10-11-16-12-14-17(18-2)15-13-16/h12-15H,3-7H2,1-2H3 |
| InChIKey | RMOBFSWAXFIJCX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|