C41H38O6 — CID 102019415
3,5-bis[(4-deca-1,3-diynylphenoxy)carbonyl]benzoic acid (PubChem CID 102019415) has the molecular formula C41H38O6 and a molecular weight of 626.75 g/mol. Its IUPAC name is 3,5-bis[(4-deca-1,3-diynylphenoxy)carbonyl]benzoic acid.
| Compound Name | 3,5-bis[(4-deca-1,3-diynylphenoxy)carbonyl]benzoic acid |
|---|---|
| PubChem CID | 102019415 |
| Molecular Formula | C41H38O6 |
| Molecular Weight | 626.75 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | 3,5-bis[(4-deca-1,3-diynylphenoxy)carbonyl]benzoic acid |
| SMILES | CCCCCCC#CC#Cc1ccc(OC(=O)c2cc(C(=O)O)cc(C(=O)Oc3ccc(C#CC#CCCCCCC)cc3)c2)cc1 |
| InChI | InChI=1S/C41H38O6/c1-3-5-7-9-11-13-15-17-19-32-21-25-37(26-22-32)46-40(44)35-29-34(39(42)43)30-36(31-35)41(45)47-38-27-23-33(24-28-38)20-18-16-14-12-10-8-6-4-2/h21-31H,3-12H2,1-2H3,(H,42,43) |
| InChIKey | BOLUTTBTLQQBCF-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.75 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|