C43H44O6 — CID 19940093
12-hydroxydodeca-5,7-diynyl 4-[4-[4-(4-pentoxyphenyl)benzoyl]oxyphenyl]benzoate (PubChem CID 19940093) has the molecular formula C43H44O6 and a molecular weight of 656.82 g/mol. Its IUPAC name is 12-hydroxydodeca-5,7-diynyl 4-[4-[4-(4-pentoxyphenyl)benzoyl]oxyphenyl]benzoate.
| Compound Name | 12-hydroxydodeca-5,7-diynyl 4-[4-[4-(4-pentoxyphenyl)benzoyl]oxyphenyl]benzoate |
|---|---|
| PubChem CID | 19940093 |
| Molecular Formula | C43H44O6 |
| Molecular Weight | 656.82 g/mol |
| Exact Mass | 656.31 |
| IUPAC Name | 12-hydroxydodeca-5,7-diynyl 4-[4-[4-(4-pentoxyphenyl)benzoyl]oxyphenyl]benzoate |
| SMILES | CCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(-c4ccc(C(=O)OCCCCC#CC#CCCCCO)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C43H44O6/c1-2-3-13-32-47-40-27-23-36(24-28-40)35-17-21-39(22-18-35)43(46)49-41-29-25-37(26-30-41)34-15-19-38(20-16-34)42(45)48-33-14-11-9-7-5-4-6-8-10-12-31-44/h15-30,44H,2-3,8-14,31-33H2,1H3 |
| InChIKey | OPGSGAIRHUNFLY-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.82 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|