C42H53ClO8 — CID 159881937
2-methylprop-2-enoyl chloride;(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-hydroxybenzoate;(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-(2-methylprop-2-enoyloxy)benzoate (PubChem CID 159881937) has the molecular formula C42H53ClO8 and a molecular weight of 721.33 g/mol. Its IUPAC name is 2-methylprop-2-enoyl chloride;(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-hydroxybenzoate;(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-(2-methylprop-2-enoyloxy)benzoate.
| Compound Name | 2-methylprop-2-enoyl chloride;(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-hydroxybenzoate;(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-(2-methylprop-2-enoyloxy)benzoate |
|---|---|
| PubChem CID | 159881937 |
| Molecular Formula | C42H53ClO8 |
| Molecular Weight | 721.33 g/mol |
| Exact Mass | 720.34 |
| IUPAC Name | 2-methylprop-2-enoyl chloride;(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-hydroxybenzoate;(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-(2-methylprop-2-enoyloxy)benzoate |
| SMILES | C=C(C)C(=O)Cl.C=C(C)C(=O)Oc1ccccc1C(=O)OC1CC2CCC1(C)C2(C)C.CC1(C)C2CCC1(C)C(OC(=O)c1ccccc1O)C2 |
| InChI | InChI=1S/C21H26O4.C17H22O3.C4H5ClO/c1-13(2)18(22)24-16-9-7-6-8-15(16)19(23)25-17-12-14-10-11-21(17,5)20(14,3)4;1-16(2)11-8-9-17(16,3)14(10-11)20-15(19)12-6-4-5-7-13(12)18;1-3(2)4(5)6/h6-9,14,17H,1,10-12H2,2-5H3;4-7,11,14,18H,8-10H2,1-3H3;1H2,2H3 |
| InChIKey | NTQBUGSDLMOTEO-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.33 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|