C17H20Br2O2 — CID 114374059
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2,5-dibromobenzoate (PubChem CID 114374059) has the molecular formula C17H20Br2O2 and a molecular weight of 416.15 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2,5-dibromobenzoate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2,5-dibromobenzoate |
|---|---|
| PubChem CID | 114374059 |
| Molecular Formula | C17H20Br2O2 |
| Molecular Weight | 416.15 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2,5-dibromobenzoate |
| SMILES | CC1(C)C2CCC1(C)C(OC(=O)c1cc(Br)ccc1Br)C2 |
| InChI | InChI=1S/C17H20Br2O2/c1-16(2)10-6-7-17(16,3)14(8-10)21-15(20)12-9-11(18)4-5-13(12)19/h4-5,9-10,14H,6-8H2,1-3H3 |
| InChIKey | IOCYUJSXLRMCLN-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.15 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |