C21H24O5 — CID 6594460
[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 6-methoxy-2-oxochromene-3-carboxylate (PubChem CID 6594460) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is [(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 6-methoxy-2-oxochromene-3-carboxylate.
| Compound Name | [(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 6-methoxy-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 6594460 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | [(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 6-methoxy-2-oxochromene-3-carboxylate |
| SMILES | COc1ccc2oc(=O)c(C(=O)O[C@@H]3C[C@@H]4CC[C@]3(C)C4(C)C)cc2c1 |
| InChI | InChI=1S/C21H24O5/c1-20(2)13-7-8-21(20,3)17(11-13)26-19(23)15-10-12-9-14(24-4)5-6-16(12)25-18(15)22/h5-6,9-10,13,17H,7-8,11H2,1-4H3/t13-,17+,21-/m0/s1 |
| InChIKey | DZBWSUUMDFCORR-IFCGJNOESA-N |
| XLogP | 4.17 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|