C17H13F3NO5- — CID 150589249
2-acetyloxy-4-[[2-hydroxy-5-(trifluoromethyl)phenyl]methylamino]benzoate (PubChem CID 150589249) has the molecular formula C17H13F3NO5- and a molecular weight of 368.29 g/mol. Its IUPAC name is 2-acetyloxy-4-[[2-hydroxy-5-(trifluoromethyl)phenyl]methylamino]benzoate.
| Compound Name | 2-acetyloxy-4-[[2-hydroxy-5-(trifluoromethyl)phenyl]methylamino]benzoate |
|---|---|
| PubChem CID | 150589249 |
| Molecular Formula | C17H13F3NO5- |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2-acetyloxy-4-[[2-hydroxy-5-(trifluoromethyl)phenyl]methylamino]benzoate |
| SMILES | CC(=O)Oc1cc(NCc2cc(C(F)(F)F)ccc2O)ccc1C(=O)[O-] |
| InChI | InChI=1S/C17H14F3NO5/c1-9(22)26-15-7-12(3-4-13(15)16(24)25)21-8-10-6-11(17(18,19)20)2-5-14(10)23/h2-7,21,23H,8H2,1H3,(H,24,25)/p-1 |
| InChIKey | IPMZYMKQJUVMQR-UHFFFAOYSA-M |
| XLogP | 2.31 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|