C9H6F3O5S- — CID 101450936
2-acetyloxy-4-(trifluoromethyl)benzenesulfonate (PubChem CID 101450936) has the molecular formula C9H6F3O5S- and a molecular weight of 283.20 g/mol. Its IUPAC name is 2-acetyloxy-4-(trifluoromethyl)benzenesulfonate.
| Compound Name | 2-acetyloxy-4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 101450936 |
| Molecular Formula | C9H6F3O5S- |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | 2-acetyloxy-4-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(=O)Oc1cc(C(F)(F)F)ccc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C9H7F3O5S/c1-5(13)17-7-4-6(9(10,11)12)2-3-8(7)18(14,15)16/h2-4H,1H3,(H,14,15,16)/p-1 |
| InChIKey | BJACOBJKTYQVDM-UHFFFAOYSA-M |
| XLogP | 1.53 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|