C15H8F6O6S2-2 — CID 154073124
2-[[2-sulfonato-5-(trifluoromethyl)phenyl]methyl]-4-(trifluoromethyl)benzenesulfonate (PubChem CID 154073124) has the molecular formula C15H8F6O6S2-2 and a molecular weight of 462.35 g/mol. Its IUPAC name is 2-[[2-sulfonato-5-(trifluoromethyl)phenyl]methyl]-4-(trifluoromethyl)benzenesulfonate.
| Compound Name | 2-[[2-sulfonato-5-(trifluoromethyl)phenyl]methyl]-4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 154073124 |
| Molecular Formula | C15H8F6O6S2-2 |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 461.97 |
| IUPAC Name | 2-[[2-sulfonato-5-(trifluoromethyl)phenyl]methyl]-4-(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(C(F)(F)F)cc1Cc1cc(C(F)(F)F)ccc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C15H10F6O6S2/c16-14(17,18)10-1-3-12(28(22,23)24)8(6-10)5-9-7-11(15(19,20)21)2-4-13(9)29(25,26)27/h1-4,6-7H,5H2,(H,22,23,24)(H,25,26,27)/p-2 |
| InChIKey | ALALGKBFVCBXKR-UHFFFAOYSA-L |
| XLogP | 3.12 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|